C37H42N2O8 — CID 54073842
(4Z)-2-methyl-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one;6-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 54073842) has the molecular formula C37H42N2O8 and a molecular weight of 642.75 g/mol. Its IUPAC name is (4Z)-2-methyl-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one;6-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | (4Z)-2-methyl-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one;6-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 54073842 |
| Molecular Formula | C37H42N2O8 |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.29 |
| IUPAC Name | (4Z)-2-methyl-4-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one;6-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | COc1cc(/C=C2\N=C(C)OC2=O)cc(OC)c1OC.COc1cc(CC2CCCc3c2[nH]c2ccc(C)cc32)cc(OC)c1OC |
| InChI | InChI=1S/C23H27NO3.C14H15NO5/c1-14-8-9-19-18(10-14)17-7-5-6-16(22(17)24-19)11-15-12-20(25-2)23(27-4)21(13-15)26-3;1-8-15-10(14(16)20-8)5-9-6-11(17-2)13(19-4)12(7-9)18-3/h8-10,12-13,16,24H,5-7,11H2,1-4H3;5-7H,1-4H3/b;10-5- |
| InChIKey | MIIGREHYEBWHPY-CIVVUWMPSA-N |
| XLogP | 7.19 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|