C37H42N2O6 — CID 54434075
(4Z)-4-[(3,4-dimethoxy-5-methylphenyl)methylidene]-2-methyl-1,3-oxazol-5-one;1-[(3,4-dimethoxy-5-methylphenyl)methyl]-6-methyl-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 54434075) has the molecular formula C37H42N2O6 and a molecular weight of 610.75 g/mol. Its IUPAC name is (4Z)-4-[(3,4-dimethoxy-5-methylphenyl)methylidene]-2-methyl-1,3-oxazol-5-one;1-[(3,4-dimethoxy-5-methylphenyl)methyl]-6-methyl-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | (4Z)-4-[(3,4-dimethoxy-5-methylphenyl)methylidene]-2-methyl-1,3-oxazol-5-one;1-[(3,4-dimethoxy-5-methylphenyl)methyl]-6-methyl-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 54434075 |
| Molecular Formula | C37H42N2O6 |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | (4Z)-4-[(3,4-dimethoxy-5-methylphenyl)methylidene]-2-methyl-1,3-oxazol-5-one;1-[(3,4-dimethoxy-5-methylphenyl)methyl]-6-methyl-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | COc1cc(/C=C2\N=C(C)OC2=O)cc(C)c1OC.COc1cc(CC2CCCc3c2[nH]c2ccc(C)cc32)cc(C)c1OC |
| InChI | InChI=1S/C23H27NO2.C14H15NO4/c1-14-8-9-20-19(10-14)18-7-5-6-17(22(18)24-20)12-16-11-15(2)23(26-4)21(13-16)25-3;1-8-5-10(7-12(17-3)13(8)18-4)6-11-14(16)19-9(2)15-11/h8-11,13,17,24H,5-7,12H2,1-4H3;5-7H,1-4H3/b;11-6- |
| InChIKey | WJNAUEKDIPCSKB-DLQLWIKLSA-N |
| XLogP | 7.79 |
| TPSA | 91.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|