C11H22N4 — CID 54095368
N,N-dibutyl-1,4-dihydro-1,3,5-triazin-2-amine (PubChem CID 54095368) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is N,N-dibutyl-1,4-dihydro-1,3,5-triazin-2-amine.
| Compound Name | N,N-dibutyl-1,4-dihydro-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 54095368 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | N,N-dibutyl-1,4-dihydro-1,3,5-triazin-2-amine |
| SMILES | CCCCN(CCCC)C1=NCN=CN1 |
| InChI | InChI=1S/C11H22N4/c1-3-5-7-15(8-6-4-2)11-13-9-12-10-14-11/h9H,3-8,10H2,1-2H3,(H,12,13,14) |
| InChIKey | MWSJVIXFHYOVNF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |