C10H13BrN2O5 — CID 54113835
(2,5-dihydroxypyrrol-1-yl) 4-[(2-bromoacetyl)amino]butanoate (PubChem CID 54113835) has the molecular formula C10H13BrN2O5 and a molecular weight of 321.13 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[(2-bromoacetyl)amino]butanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[(2-bromoacetyl)amino]butanoate |
|---|---|
| PubChem CID | 54113835 |
| Molecular Formula | C10H13BrN2O5 |
| Molecular Weight | 321.13 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[(2-bromoacetyl)amino]butanoate |
| SMILES | O=C(CBr)NCCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C10H13BrN2O5/c11-6-7(14)12-5-1-2-10(17)18-13-8(15)3-4-9(13)16/h3-4,15-16H,1-2,5-6H2,(H,12,14) |
| InChIKey | NIYHYVPSBJRDCR-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.13 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|