C15H29N5O3 — CID 54125507
2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]-(cyclohexylmethyl)amino]acetic acid (PubChem CID 54125507) has the molecular formula C15H29N5O3 and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]-(cyclohexylmethyl)amino]acetic acid.
| Compound Name | 2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]-(cyclohexylmethyl)amino]acetic acid |
|---|---|
| PubChem CID | 54125507 |
| Molecular Formula | C15H29N5O3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]-(cyclohexylmethyl)amino]acetic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)N(CC(=O)O)CC1CCCCC1 |
| InChI | InChI=1S/C15H29N5O3/c16-12(7-4-8-19-15(17)18)14(23)20(10-13(21)22)9-11-5-2-1-3-6-11/h11-12H,1-10,16H2,(H,21,22)(H4,17,18,19)/t12-/m0/s1 |
| InChIKey | NQRLGFNJDLBAAE-LBPRGKRZSA-N |
| XLogP | -0.14 |
| TPSA | 148.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|