C8H13N3O3 — CID 54154389
ethyl 6-amino-3-(hydroxymethyl)-4H-pyrimidine-4-carboxylate (PubChem CID 54154389) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is ethyl 6-amino-3-(hydroxymethyl)-4H-pyrimidine-4-carboxylate.
| Compound Name | ethyl 6-amino-3-(hydroxymethyl)-4H-pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 54154389 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | ethyl 6-amino-3-(hydroxymethyl)-4H-pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)C1C=C(N)N=CN1CO |
| InChI | InChI=1S/C8H13N3O3/c1-2-14-8(13)6-3-7(9)10-4-11(6)5-12/h3-4,6,12H,2,5,9H2,1H3 |
| InChIKey | OJZMGLRRJALKOL-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |