C15H18 — CID 54191398
3,7,11-trimethyltetracyclo[8.2.0.02,5.06,9]dodeca-1(10),2(5),6(9)-triene (PubChem CID 54191398) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 3,7,11-trimethyltetracyclo[8.2.0.02,5.06,9]dodeca-1(10),2(5),6(9)-triene.
| Compound Name | 3,7,11-trimethyltetracyclo[8.2.0.02,5.06,9]dodeca-1(10),2(5),6(9)-triene |
|---|---|
| PubChem CID | 54191398 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 3,7,11-trimethyltetracyclo[8.2.0.02,5.06,9]dodeca-1(10),2(5),6(9)-triene |
| SMILES | CC1Cc2c1c1c(c3c2C(C)C3)C(C)C1 |
| InChI | InChI=1S/C15H18/c1-7-4-10-13(7)11-5-8(2)15(11)12-6-9(3)14(10)12/h7-9H,4-6H2,1-3H3 |
| InChIKey | PITVMCLKDILWTP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |