C21H28O8 — CID 67068858
decanedioic acid;7-methylbicyclo[4.2.0]octa-1,3,5-triene-2,5-dicarboxylic acid (PubChem CID 67068858) has the molecular formula C21H28O8 and a molecular weight of 408.45 g/mol. Its IUPAC name is decanedioic acid;7-methylbicyclo[4.2.0]octa-1,3,5-triene-2,5-dicarboxylic acid.
| Compound Name | decanedioic acid;7-methylbicyclo[4.2.0]octa-1,3,5-triene-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 67068858 |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | decanedioic acid;7-methylbicyclo[4.2.0]octa-1,3,5-triene-2,5-dicarboxylic acid |
| SMILES | CC1Cc2c(C(=O)O)ccc(C(=O)O)c21.O=C(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C11H10O4.C10H18O4/c1-5-4-8-6(10(12)13)2-3-7(9(5)8)11(14)15;11-9(12)7-5-3-1-2-4-6-8-10(13)14/h2-3,5H,4H2,1H3,(H,12,13)(H,14,15);1-8H2,(H,11,12)(H,13,14) |
| InChIKey | BQHRJBODRJMGBR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|