C8H12Cl2N6O2 — CID 54200707
1-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]ethyl]-3-(2-hydroxyethyl)urea (PubChem CID 54200707) has the molecular formula C8H12Cl2N6O2 and a molecular weight of 295.13 g/mol. Its IUPAC name is 1-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]ethyl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]ethyl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 54200707 |
| Molecular Formula | C8H12Cl2N6O2 |
| Molecular Weight | 295.13 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 1-[2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]ethyl]-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)NCCNc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C8H12Cl2N6O2/c9-5-14-6(10)16-7(15-5)11-1-2-12-8(18)13-3-4-17/h17H,1-4H2,(H2,12,13,18)(H,11,14,15,16) |
| InChIKey | PPAPKUYKYUAZGL-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.13 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|