C18H19N3O7 — CID 54225183
(2S)-3-[4-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]oxyphenyl]-2-nitramidopropanoic acid (PubChem CID 54225183) has the molecular formula C18H19N3O7 and a molecular weight of 389.36 g/mol. Its IUPAC name is (2S)-3-[4-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]oxyphenyl]-2-nitramidopropanoic acid.
| Compound Name | (2S)-3-[4-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]oxyphenyl]-2-nitramidopropanoic acid |
|---|---|
| PubChem CID | 54225183 |
| Molecular Formula | C18H19N3O7 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | (2S)-3-[4-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]oxyphenyl]-2-nitramidopropanoic acid |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)Oc1ccc(C[C@H](N[N+](=O)[O-])C(=O)O)cc1 |
| InChI | InChI=1S/C18H19N3O7/c19-15(9-11-1-5-13(22)6-2-11)18(25)28-14-7-3-12(4-8-14)10-16(17(23)24)20-21(26)27/h1-8,15-16,20,22H,9-10,19H2,(H,23,24)/t15-,16-/m0/s1 |
| InChIKey | QFIQMKPMPIXMGE-HOTGVXAUSA-N |
| XLogP | 0.64 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|