C23H26N2O4S2 — CID 54278675
2-[6-[(2-benzyl-3-sulfanylpropanoyl)amino]-5-oxo-3-phenyl-1,4-thiazepan-4-yl]acetic acid (PubChem CID 54278675) has the molecular formula C23H26N2O4S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 2-[6-[(2-benzyl-3-sulfanylpropanoyl)amino]-5-oxo-3-phenyl-1,4-thiazepan-4-yl]acetic acid.
| Compound Name | 2-[6-[(2-benzyl-3-sulfanylpropanoyl)amino]-5-oxo-3-phenyl-1,4-thiazepan-4-yl]acetic acid |
|---|---|
| PubChem CID | 54278675 |
| Molecular Formula | C23H26N2O4S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 2-[6-[(2-benzyl-3-sulfanylpropanoyl)amino]-5-oxo-3-phenyl-1,4-thiazepan-4-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C(NC(=O)C(CS)Cc2ccccc2)CSCC1c1ccccc1 |
| InChI | InChI=1S/C23H26N2O4S2/c26-21(27)12-25-20(17-9-5-2-6-10-17)15-31-14-19(23(25)29)24-22(28)18(13-30)11-16-7-3-1-4-8-16/h1-10,18-20,30H,11-15H2,(H,24,28)(H,26,27) |
| InChIKey | RPFUTHPKYWZKJI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|