C24H27F2NO4 — CID 54299474
3-[4-[(2,6-difluorophenyl)methoxy]-3-(3-oxopropoxy)phenyl]-N,N-diethylbut-2-enamide (PubChem CID 54299474) has the molecular formula C24H27F2NO4 and a molecular weight of 431.48 g/mol. Its IUPAC name is 3-[4-[(2,6-difluorophenyl)methoxy]-3-(3-oxopropoxy)phenyl]-N,N-diethylbut-2-enamide.
| Compound Name | 3-[4-[(2,6-difluorophenyl)methoxy]-3-(3-oxopropoxy)phenyl]-N,N-diethylbut-2-enamide |
|---|---|
| PubChem CID | 54299474 |
| Molecular Formula | C24H27F2NO4 |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 3-[4-[(2,6-difluorophenyl)methoxy]-3-(3-oxopropoxy)phenyl]-N,N-diethylbut-2-enamide |
| SMILES | CCN(CC)C(=O)C=C(C)c1ccc(OCc2c(F)cccc2F)c(OCCC=O)c1 |
| InChI | InChI=1S/C24H27F2NO4/c1-4-27(5-2)24(29)14-17(3)18-10-11-22(23(15-18)30-13-7-12-28)31-16-19-20(25)8-6-9-21(19)26/h6,8-12,14-15H,4-5,7,13,16H2,1-3H3 |
| InChIKey | SDEIJDJYFBITMX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|