C20H36NO4P — CID 54299779
N-(1-dimethoxyphosphoryl-4,8,12-trimethyltrideca-3,7,11-trien-2-yl)acetamide (PubChem CID 54299779) has the molecular formula C20H36NO4P and a molecular weight of 385.49 g/mol. Its IUPAC name is N-(1-dimethoxyphosphoryl-4,8,12-trimethyltrideca-3,7,11-trien-2-yl)acetamide.
| Compound Name | N-(1-dimethoxyphosphoryl-4,8,12-trimethyltrideca-3,7,11-trien-2-yl)acetamide |
|---|---|
| PubChem CID | 54299779 |
| Molecular Formula | C20H36NO4P |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N-(1-dimethoxyphosphoryl-4,8,12-trimethyltrideca-3,7,11-trien-2-yl)acetamide |
| SMILES | COP(=O)(CC(C=C(C)CCC=C(C)CCC=C(C)C)NC(C)=O)OC |
| InChI | InChI=1S/C20H36NO4P/c1-16(2)10-8-11-17(3)12-9-13-18(4)14-20(21-19(5)22)15-26(23,24-6)25-7/h10,12,14,20H,8-9,11,13,15H2,1-7H3,(H,21,22) |
| InChIKey | SDJRCOSYIVZJSI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|