C11H19N9S2 — CID 54303182
1-cyano-2-methyl-3-[2-[[N'-[2-(1,3,4-thiadiazol-2-ylmethylsulfanyl)ethyl]carbamimidoyl]amino]ethyl]guanidine (PubChem CID 54303182) has the molecular formula C11H19N9S2 and a molecular weight of 341.47 g/mol. Its IUPAC name is 1-cyano-2-methyl-3-[2-[[N'-[2-(1,3,4-thiadiazol-2-ylmethylsulfanyl)ethyl]carbamimidoyl]amino]ethyl]guanidine.
| Compound Name | 1-cyano-2-methyl-3-[2-[[N'-[2-(1,3,4-thiadiazol-2-ylmethylsulfanyl)ethyl]carbamimidoyl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 54303182 |
| Molecular Formula | C11H19N9S2 |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1-cyano-2-methyl-3-[2-[[N'-[2-(1,3,4-thiadiazol-2-ylmethylsulfanyl)ethyl]carbamimidoyl]amino]ethyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCN/C(N)=N/CCSCc1nncs1 |
| InChI | InChI=1S/C11H19N9S2/c1-14-11(18-7-12)17-3-2-15-10(13)16-4-5-21-6-9-20-19-8-22-9/h8H,2-6H2,1H3,(H3,13,15,16)(H2,14,17,18) |
| InChIKey | SFQZGANYKSECFY-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|