C7H10O2S — CID 54309768
3λ6-thiatricyclo[3.2.1.02,4]octane 3,3-dioxide (PubChem CID 54309768) has the molecular formula C7H10O2S and a molecular weight of 158.22 g/mol. Its IUPAC name is 3λ6-thiatricyclo[3.2.1.02,4]octane 3,3-dioxide.
| Compound Name | 3λ6-thiatricyclo[3.2.1.02,4]octane 3,3-dioxide |
|---|---|
| PubChem CID | 54309768 |
| Molecular Formula | C7H10O2S |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.04 |
| IUPAC Name | 3λ6-thiatricyclo[3.2.1.02,4]octane 3,3-dioxide |
| SMILES | O=S1(=O)C2C3CCC(C3)C21 |
| InChI | InChI=1S/C7H10O2S/c8-10(9)6-4-1-2-5(3-4)7(6)10/h4-7H,1-3H2 |
| InChIKey | SKBJJOXMMTWBCB-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|