About N-(diethoxymethyl)-1,1-diethoxymethanamine
N-(diethoxymethyl)-1,1-diethoxymethanamine (PubChem CID 54336091) has the molecular formula C10H23NO4
and a molecular weight of 221.30 g/mol. Its IUPAC name is N-(diethoxymethyl)-1,1-diethoxymethanamine.
Molecular Properties
| Compound Name | N-(diethoxymethyl)-1,1-diethoxymethanamine |
| PubChem CID | 54336091 |
| Molecular Formula | C10H23NO4 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | N-(diethoxymethyl)-1,1-diethoxymethanamine |
| SMILES | CCOC(NC(OCC)OCC)OCC |
| InChI | InChI=1S/C10H23NO4/c1-5-12-9(13-6-2)11-10(14-7-3)15-8-4/h9-11H,5-8H2,1-4H3 |
| InChIKey | QJCKBDJPBYKLPU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(diethoxymethyl)-1,1-diethoxymethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diethoxymethyl)-1,1-diethoxymethanamine?
The IUPAC name of N-(diethoxymethyl)-1,1-diethoxymethanamine (CID 54336091) is N-(diethoxymethyl)-1,1-diethoxymethanamine.
What is the SMILES notation for N-(diethoxymethyl)-1,1-diethoxymethanamine?
The canonical SMILES for N-(diethoxymethyl)-1,1-diethoxymethanamine is CCOC(NC(OCC)OCC)OCC.
What is the InChIKey of N-(diethoxymethyl)-1,1-diethoxymethanamine?
The InChIKey is QJCKBDJPBYKLPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO4/c1-5-12-9(13-6-2)11-10(14-7-3)15-8-4/h9-11H,5-8H2,1-4H3.
What are the key properties of N-(diethoxymethyl)-1,1-diethoxymethanamine?
N-(diethoxymethyl)-1,1-diethoxymethanamine has a molecular weight of 221.30 g/mol, XLogP of 1.29, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diethoxymethyl)-1,1-diethoxymethanamine is sourced from PubChem (CID 54336091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).