C28H23N3O4 — CID 54342818
1-[1-(2,3-dihydro-1-benzofuran-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(3-nitrophenyl)prop-2-en-1-one (PubChem CID 54342818) has the molecular formula C28H23N3O4 and a molecular weight of 465.51 g/mol. Its IUPAC name is 1-[1-(2,3-dihydro-1-benzofuran-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(3-nitrophenyl)prop-2-en-1-one.
| Compound Name | 1-[1-(2,3-dihydro-1-benzofuran-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54342818 |
| Molecular Formula | C28H23N3O4 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 1-[1-(2,3-dihydro-1-benzofuran-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-(3-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cccc([N+](=O)[O-])c1)N1CCc2c([nH]c3ccccc23)C1C1Cc2ccccc2O1 |
| InChI | InChI=1S/C28H23N3O4/c32-26(13-12-18-6-5-8-20(16-18)31(33)34)30-15-14-22-21-9-2-3-10-23(21)29-27(22)28(30)25-17-19-7-1-4-11-24(19)35-25/h1-13,16,25,28-29H,14-15,17H2 |
| InChIKey | UAEPAJHHLAIXPL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|