C29H24ClN3O4 — CID 54539622
4-(2-chloro-5-nitrophenyl)-1-[1-(2,3-dihydro-1-benzofuran-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]but-2-en-1-one (PubChem CID 54539622) has the molecular formula C29H24ClN3O4 and a molecular weight of 513.98 g/mol. Its IUPAC name is 4-(2-chloro-5-nitrophenyl)-1-[1-(2,3-dihydro-1-benzofuran-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]but-2-en-1-one.
| Compound Name | 4-(2-chloro-5-nitrophenyl)-1-[1-(2,3-dihydro-1-benzofuran-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 54539622 |
| Molecular Formula | C29H24ClN3O4 |
| Molecular Weight | 513.98 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 4-(2-chloro-5-nitrophenyl)-1-[1-(2,3-dihydro-1-benzofuran-2-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]but-2-en-1-one |
| SMILES | O=C(C=CCc1cc([N+](=O)[O-])ccc1Cl)N1CCc2c([nH]c3ccccc23)C1C1Cc2ccccc2O1 |
| InChI | InChI=1S/C29H24ClN3O4/c30-23-13-12-20(33(35)36)16-18(23)7-5-11-27(34)32-15-14-22-21-8-2-3-9-24(21)31-28(22)29(32)26-17-19-6-1-4-10-25(19)37-26/h1-6,8-13,16,26,29,31H,7,14-15,17H2 |
| InChIKey | ZCFPPAGUFQOPLS-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.98 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|