C12H21N2O3+ — CID 54392651
2-(6-amino-2-methylidene-6-oxohex-4-enoyl)oxyethyl-trimethylazanium (PubChem CID 54392651) has the molecular formula C12H21N2O3+ and a molecular weight of 241.31 g/mol. Its IUPAC name is 2-(6-amino-2-methylidene-6-oxohex-4-enoyl)oxyethyl-trimethylazanium.
| Compound Name | 2-(6-amino-2-methylidene-6-oxohex-4-enoyl)oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 54392651 |
| Molecular Formula | C12H21N2O3+ |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-(6-amino-2-methylidene-6-oxohex-4-enoyl)oxyethyl-trimethylazanium |
| SMILES | C=C(CC=CC(N)=O)C(=O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C12H20N2O3/c1-10(6-5-7-11(13)15)12(16)17-9-8-14(2,3)4/h5,7H,1,6,8-9H2,2-4H3,(H-,13,15)/p+1 |
| InChIKey | VHTFAQRMSBJTIX-UHFFFAOYSA-O |
| XLogP | 0.22 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|