C11H20F6N6O2 — CID 54392780
N-[[2-aminoethyl-[2-(2-aminoethylamino)ethyl]amino]-[(2,2,2-trifluoroacetyl)amino]methyl]-2,2,2-trifluoroacetamide (PubChem CID 54392780) has the molecular formula C11H20F6N6O2 and a molecular weight of 382.31 g/mol. Its IUPAC name is N-[[2-aminoethyl-[2-(2-aminoethylamino)ethyl]amino]-[(2,2,2-trifluoroacetyl)amino]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[2-aminoethyl-[2-(2-aminoethylamino)ethyl]amino]-[(2,2,2-trifluoroacetyl)amino]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 54392780 |
| Molecular Formula | C11H20F6N6O2 |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-[[2-aminoethyl-[2-(2-aminoethylamino)ethyl]amino]-[(2,2,2-trifluoroacetyl)amino]methyl]-2,2,2-trifluoroacetamide |
| SMILES | NCCNCCN(CCN)C(NC(=O)C(F)(F)F)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H20F6N6O2/c12-10(13,14)7(24)21-9(22-8(25)11(15,16)17)23(5-2-19)6-4-20-3-1-18/h9,20H,1-6,18-19H2,(H,21,24)(H,22,25) |
| InChIKey | VHVMKNNEBRNBGW-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 125.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|