C23H41N3OS2 — CID 54409449
N-(4-ethoxy-6-methylsulfanylpyrimidin-5-yl)-2-hexyldecanethioamide (PubChem CID 54409449) has the molecular formula C23H41N3OS2 and a molecular weight of 439.74 g/mol. Its IUPAC name is N-(4-ethoxy-6-methylsulfanylpyrimidin-5-yl)-2-hexyldecanethioamide.
| Compound Name | N-(4-ethoxy-6-methylsulfanylpyrimidin-5-yl)-2-hexyldecanethioamide |
|---|---|
| PubChem CID | 54409449 |
| Molecular Formula | C23H41N3OS2 |
| Molecular Weight | 439.74 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | N-(4-ethoxy-6-methylsulfanylpyrimidin-5-yl)-2-hexyldecanethioamide |
| SMILES | CCCCCCCCC(CCCCCC)C(=S)Nc1c(OCC)ncnc1SC |
| InChI | InChI=1S/C23H41N3OS2/c1-5-8-10-12-13-15-17-19(16-14-11-9-6-2)22(28)26-20-21(27-7-3)24-18-25-23(20)29-4/h18-19H,5-17H2,1-4H3,(H,26,28) |
| InChIKey | VTBLUPFCOQWELA-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.74 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|