C12H14ClN3O3 — CID 54413210
2-amino-5-chloro-3-cyano-N,N-bis(2-hydroxyethyl)benzamide (PubChem CID 54413210) has the molecular formula C12H14ClN3O3 and a molecular weight of 283.71 g/mol. Its IUPAC name is 2-amino-5-chloro-3-cyano-N,N-bis(2-hydroxyethyl)benzamide.
| Compound Name | 2-amino-5-chloro-3-cyano-N,N-bis(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 54413210 |
| Molecular Formula | C12H14ClN3O3 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2-amino-5-chloro-3-cyano-N,N-bis(2-hydroxyethyl)benzamide |
| SMILES | N#Cc1cc(Cl)cc(C(=O)N(CCO)CCO)c1N |
| InChI | InChI=1S/C12H14ClN3O3/c13-9-5-8(7-14)11(15)10(6-9)12(19)16(1-3-17)2-4-18/h5-6,17-18H,1-4,15H2 |
| InChIKey | VVPFLLGAGSUIPB-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 110.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|