C14H16F3N5O3 — CID 54441165
1-(3,4-diethoxyphenyl)-4-[2-(trifluoromethyl)hydrazinyl]-1,3,5-triazin-2-one (PubChem CID 54441165) has the molecular formula C14H16F3N5O3 and a molecular weight of 359.31 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)-4-[2-(trifluoromethyl)hydrazinyl]-1,3,5-triazin-2-one.
| Compound Name | 1-(3,4-diethoxyphenyl)-4-[2-(trifluoromethyl)hydrazinyl]-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 54441165 |
| Molecular Formula | C14H16F3N5O3 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)-4-[2-(trifluoromethyl)hydrazinyl]-1,3,5-triazin-2-one |
| SMILES | CCOc1ccc(-n2cnc(NNC(F)(F)F)nc2=O)cc1OCC |
| InChI | InChI=1S/C14H16F3N5O3/c1-3-24-10-6-5-9(7-11(10)25-4-2)22-8-18-12(19-13(22)23)20-21-14(15,16)17/h5-8,21H,3-4H2,1-2H3,(H,19,20,23) |
| InChIKey | WOEQQIDEFWXEOH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|