C19H21N5O3 — CID 54436662
1-(3,4-diethoxyphenyl)-4-(2-phenylhydrazinyl)-1,3,5-triazin-2-one (PubChem CID 54436662) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)-4-(2-phenylhydrazinyl)-1,3,5-triazin-2-one.
| Compound Name | 1-(3,4-diethoxyphenyl)-4-(2-phenylhydrazinyl)-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 54436662 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)-4-(2-phenylhydrazinyl)-1,3,5-triazin-2-one |
| SMILES | CCOc1ccc(-n2cnc(NNc3ccccc3)nc2=O)cc1OCC |
| InChI | InChI=1S/C19H21N5O3/c1-3-26-16-11-10-15(12-17(16)27-4-2)24-13-20-18(21-19(24)25)23-22-14-8-6-5-7-9-14/h5-13,22H,3-4H2,1-2H3,(H,21,23,25) |
| InChIKey | WLFBANZNCDOPSY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|