C14H20O6S — CID 54441407
[(1R,2R)-2-(3,4,5-trimethoxyphenyl)cyclopropyl]methyl methanesulfonate (PubChem CID 54441407) has the molecular formula C14H20O6S and a molecular weight of 316.38 g/mol. Its IUPAC name is [(1R,2R)-2-(3,4,5-trimethoxyphenyl)cyclopropyl]methyl methanesulfonate.
| Compound Name | [(1R,2R)-2-(3,4,5-trimethoxyphenyl)cyclopropyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 54441407 |
| Molecular Formula | C14H20O6S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | [(1R,2R)-2-(3,4,5-trimethoxyphenyl)cyclopropyl]methyl methanesulfonate |
| SMILES | COc1cc([C@@H]2C[C@H]2COS(C)(=O)=O)cc(OC)c1OC |
| InChI | InChI=1S/C14H20O6S/c1-17-12-6-9(7-13(18-2)14(12)19-3)11-5-10(11)8-20-21(4,15)16/h6-7,10-11H,5,8H2,1-4H3/t10-,11-/m0/s1 |
| InChIKey | WOJCCSKRQWHEDA-QWRGUYRKSA-N |
| XLogP | 1.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|