About 3-nitrosopentan-2-one
3-nitrosopentan-2-one (PubChem CID 54457186) has the molecular formula C5H9NO2
and a molecular weight of 115.13 g/mol. Its IUPAC name is 3-nitrosopentan-2-one.
Molecular Properties
| Compound Name | 3-nitrosopentan-2-one |
| PubChem CID | 54457186 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | 3-nitrosopentan-2-one |
| SMILES | CCC(N=O)C(C)=O |
| InChI | InChI=1S/C5H9NO2/c1-3-5(6-8)4(2)7/h5H,3H2,1-2H3 |
| InChIKey | WZAKKBBCAUABGU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-nitrosopentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrosopentan-2-one?
The IUPAC name of 3-nitrosopentan-2-one (CID 54457186) is 3-nitrosopentan-2-one.
What is the SMILES notation for 3-nitrosopentan-2-one?
The canonical SMILES for 3-nitrosopentan-2-one is CCC(N=O)C(C)=O.
What is the InChIKey of 3-nitrosopentan-2-one?
The InChIKey is WZAKKBBCAUABGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2/c1-3-5(6-8)4(2)7/h5H,3H2,1-2H3.
What are the key properties of 3-nitrosopentan-2-one?
3-nitrosopentan-2-one has a molecular weight of 115.13 g/mol, XLogP of 1.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrosopentan-2-one is sourced from PubChem (CID 54457186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).