C30H36NO6P — CID 54482148
2-[[(3S)-3-(diethoxyphosphorylmethyl)-2-oxo-1-phenyl-4-(4-phenylphenyl)butyl]amino]propanoic acid (PubChem CID 54482148) has the molecular formula C30H36NO6P and a molecular weight of 537.59 g/mol. Its IUPAC name is 2-[[(3S)-3-(diethoxyphosphorylmethyl)-2-oxo-1-phenyl-4-(4-phenylphenyl)butyl]amino]propanoic acid.
| Compound Name | 2-[[(3S)-3-(diethoxyphosphorylmethyl)-2-oxo-1-phenyl-4-(4-phenylphenyl)butyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54482148 |
| Molecular Formula | C30H36NO6P |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 2-[[(3S)-3-(diethoxyphosphorylmethyl)-2-oxo-1-phenyl-4-(4-phenylphenyl)butyl]amino]propanoic acid |
| SMILES | CCOP(=O)(CC(Cc1ccc(-c2ccccc2)cc1)C(=O)C(NC(C)C(=O)O)c1ccccc1)OCC |
| InChI | InChI=1S/C30H36NO6P/c1-4-36-38(35,37-5-2)21-27(20-23-16-18-25(19-17-23)24-12-8-6-9-13-24)29(32)28(31-22(3)30(33)34)26-14-10-7-11-15-26/h6-19,22,27-28,31H,4-5,20-21H2,1-3H3,(H,33,34) |
| InChIKey | XPTDWDKXEBPTJZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|