C9H9BrN2S — CID 54519949
5-(2-bromoethyl)-1,3-benzothiazol-2-amine (PubChem CID 54519949) has the molecular formula C9H9BrN2S and a molecular weight of 257.16 g/mol. Its IUPAC name is 5-(2-bromoethyl)-1,3-benzothiazol-2-amine.
| Compound Name | 5-(2-bromoethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 54519949 |
| Molecular Formula | C9H9BrN2S |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 5-(2-bromoethyl)-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2cc(CCBr)ccc2s1 |
| InChI | InChI=1S/C9H9BrN2S/c10-4-3-6-1-2-8-7(5-6)12-9(11)13-8/h1-2,5H,3-4H2,(H2,11,12) |
| InChIKey | YPBSFVVQDYXXFO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|