C20H20N2O6S2 — CID 54549052
3-N,3-N-bis[2-(hydroxymethyl)phenyl]benzene-1,3-disulfonamide (PubChem CID 54549052) has the molecular formula C20H20N2O6S2 and a molecular weight of 448.52 g/mol. Its IUPAC name is 3-N,3-N-bis[2-(hydroxymethyl)phenyl]benzene-1,3-disulfonamide.
| Compound Name | 3-N,3-N-bis[2-(hydroxymethyl)phenyl]benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 54549052 |
| Molecular Formula | C20H20N2O6S2 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 3-N,3-N-bis[2-(hydroxymethyl)phenyl]benzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)N(c2ccccc2CO)c2ccccc2CO)c1 |
| InChI | InChI=1S/C20H20N2O6S2/c21-29(25,26)17-8-5-9-18(12-17)30(27,28)22(19-10-3-1-6-15(19)13-23)20-11-4-2-7-16(20)14-24/h1-12,23-24H,13-14H2,(H2,21,25,26) |
| InChIKey | ZIPRURVZCFUCPD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |