C23H31N3O5S — CID 54583886
7-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]heptyl methanesulfonate (PubChem CID 54583886) has the molecular formula C23H31N3O5S and a molecular weight of 461.58 g/mol. Its IUPAC name is 7-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]heptyl methanesulfonate.
| Compound Name | 7-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]heptyl methanesulfonate |
|---|---|
| PubChem CID | 54583886 |
| Molecular Formula | C23H31N3O5S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 7-[3-[2-(dimethylamino)ethyl]-4,9-dioxopyrrolo[3,2-g]isoquinolin-1-yl]heptyl methanesulfonate |
| SMILES | CN(C)CCc1cn(CCCCCCCOS(C)(=O)=O)c2c1C(=O)c1ccncc1C2=O |
| InChI | InChI=1S/C23H31N3O5S/c1-25(2)13-10-17-16-26(12-7-5-4-6-8-14-31-32(3,29)30)21-20(17)22(27)18-9-11-24-15-19(18)23(21)28/h9,11,15-16H,4-8,10,12-14H2,1-3H3 |
| InChIKey | NIYMMFUAYBGYEK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|