C18H16N4S — CID 54587313
1-(1-benzothiophen-2-yl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine (PubChem CID 54587313) has the molecular formula C18H16N4S and a molecular weight of 320.42 g/mol. Its IUPAC name is 1-(1-benzothiophen-2-yl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine.
| Compound Name | 1-(1-benzothiophen-2-yl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 54587313 |
| Molecular Formula | C18H16N4S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 1-(1-benzothiophen-2-yl)-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine |
| SMILES | Nc1nccn2c(C3CCC3)nc(-c3cc4ccccc4s3)c12 |
| InChI | InChI=1S/C18H16N4S/c19-17-16-15(14-10-12-4-1-2-7-13(12)23-14)21-18(11-5-3-6-11)22(16)9-8-20-17/h1-2,4,7-11H,3,5-6H2,(H2,19,20) |
| InChIKey | LQZZHQUOTKKDLP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |