C8H6Br2O4 — CID 54589805
2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid (PubChem CID 54589805) has the molecular formula C8H6Br2O4 and a molecular weight of 325.94 g/mol. Its IUPAC name is 2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid.
| Compound Name | 2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 54589805 |
| Molecular Formula | C8H6Br2O4 |
| Molecular Weight | 325.94 g/mol |
| Exact Mass | 323.86 |
| IUPAC Name | 2-(2,3-dibromo-4,5-dihydroxyphenyl)acetic acid |
| SMILES | O=C(O)Cc1cc(O)c(O)c(Br)c1Br |
| InChI | InChI=1S/C8H6Br2O4/c9-6-3(2-5(12)13)1-4(11)8(14)7(6)10/h1,11,14H,2H2,(H,12,13) |
| InChIKey | WZCWYJGRTOEZPC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.94 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|