C13H23N — CID 546547
4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-amine (PubChem CID 546547) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-amine.
| Compound Name | 4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-amine |
|---|---|
| PubChem CID | 546547 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-amine |
| SMILES | CC1=C(C=CC(C)N)C(C)(C)CCC1 |
| InChI | InChI=1S/C13H23N/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h7-8,11H,5-6,9,14H2,1-4H3 |
| InChIKey | GMKBUWVORFVWQR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |