C30H52N2O2 — CID 5468255
(2S,5Z,8Z,11Z,14Z,17Z,20Z,29S)-2,29-diaminotriaconta-5,8,11,14,17,20-hexaene-3,28-diol (PubChem CID 5468255) has the molecular formula C30H52N2O2 and a molecular weight of 472.76 g/mol. Its IUPAC name is (2S,5Z,8Z,11Z,14Z,17Z,20Z,29S)-2,29-diaminotriaconta-5,8,11,14,17,20-hexaene-3,28-diol.
| Compound Name | (2S,5Z,8Z,11Z,14Z,17Z,20Z,29S)-2,29-diaminotriaconta-5,8,11,14,17,20-hexaene-3,28-diol |
|---|---|
| PubChem CID | 5468255 |
| Molecular Formula | C30H52N2O2 |
| Molecular Weight | 472.76 g/mol |
| Exact Mass | 472.40 |
| IUPAC Name | (2S,5Z,8Z,11Z,14Z,17Z,20Z,29S)-2,29-diaminotriaconta-5,8,11,14,17,20-hexaene-3,28-diol |
| SMILES | C[C@H](N)C(O)C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(O)[C@H](C)N |
| InChI | InChI=1S/C30H52N2O2/c1-27(31)29(33)25-23-21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24-26-30(34)28(2)32/h3,5-6,8-9,11-12,14-15,17,21,23,27-30,33-34H,4,7,10,13,16,18-20,22,24-26,31-32H2,1-2H3/b5-3-,8-6-,11-9-,14-12-,17-15-,23-21-/t27-,28-,29?,30?/m0/s1 |
| InChIKey | CXFKWMQQNSTRAS-UEBLXSIFSA-N |
| XLogP | 6.42 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.76 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|