C24H19N2+ — CID 5469867
(4Z)-4-benzylidene-1-methyl-2-phenylpyrazolo[1,5-a]indol-1-ium (PubChem CID 5469867) has the molecular formula C24H19N2+ and a molecular weight of 335.43 g/mol. Its IUPAC name is (4Z)-4-benzylidene-1-methyl-2-phenylpyrazolo[1,5-a]indol-1-ium.
| Compound Name | (4Z)-4-benzylidene-1-methyl-2-phenylpyrazolo[1,5-a]indol-1-ium |
|---|---|
| PubChem CID | 5469867 |
| Molecular Formula | C24H19N2+ |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (4Z)-4-benzylidene-1-methyl-2-phenylpyrazolo[1,5-a]indol-1-ium |
| SMILES | C[n+]1c(-c2ccccc2)cc2/c(=C\c3ccccc3)c3ccccc3n21 |
| InChI | InChI=1S/C24H19N2/c1-25-23(19-12-6-3-7-13-19)17-24-21(16-18-10-4-2-5-11-18)20-14-8-9-15-22(20)26(24)25/h2-17H,1H3/q+1/b21-16- |
| InChIKey | PEODWEZQVBCRQA-PGMHBOJBSA-N |
| XLogP | 4.13 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|