C13H11O6- — CID 54713306
5-[(E)-2-carboxyethenyl]-4,7-dimethoxy-1-benzofuran-6-olate (PubChem CID 54713306) has the molecular formula C13H11O6- and a molecular weight of 263.23 g/mol. Its IUPAC name is 5-[(E)-2-carboxyethenyl]-4,7-dimethoxy-1-benzofuran-6-olate.
| Compound Name | 5-[(E)-2-carboxyethenyl]-4,7-dimethoxy-1-benzofuran-6-olate |
|---|---|
| PubChem CID | 54713306 |
| Molecular Formula | C13H11O6- |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 5-[(E)-2-carboxyethenyl]-4,7-dimethoxy-1-benzofuran-6-olate |
| SMILES | COc1c(/C=C/C(=O)O)c([O-])c(OC)c2occc12 |
| InChI | InChI=1S/C13H12O6/c1-17-11-7(3-4-9(14)15)10(16)13(18-2)12-8(11)5-6-19-12/h3-6,16H,1-2H3,(H,14,15)/p-1/b4-3+ |
| InChIKey | OZUKJVVCLQNGHV-ONEGZZNKSA-M |
| XLogP | 1.62 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|