C32H40N3O13S3+ — CID 54751128
2-[(E)-2-[7-(diethylamino)-4-hydroxy-2-oxochromen-3-yl]ethenyl]-3-methyl-3-[4-oxo-4-(sulfomethylamino)butyl]-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid (PubChem CID 54751128) has the molecular formula C32H40N3O13S3+ and a molecular weight of 770.88 g/mol. Its IUPAC name is 2-[(E)-2-[7-(diethylamino)-4-hydroxy-2-oxochromen-3-yl]ethenyl]-3-methyl-3-[4-oxo-4-(sulfomethylamino)butyl]-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid.
| Compound Name | 2-[(E)-2-[7-(diethylamino)-4-hydroxy-2-oxochromen-3-yl]ethenyl]-3-methyl-3-[4-oxo-4-(sulfomethylamino)butyl]-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 54751128 |
| Molecular Formula | C32H40N3O13S3+ |
| Molecular Weight | 770.88 g/mol |
| Exact Mass | 770.17 |
| IUPAC Name | 2-[(E)-2-[7-(diethylamino)-4-hydroxy-2-oxochromen-3-yl]ethenyl]-3-methyl-3-[4-oxo-4-(sulfomethylamino)butyl]-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
| SMILES | CCN(CC)c1ccc2c(O)c(/C=C/C3=[N+](CCCS(=O)(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)CCCC(=O)NCS(=O)(=O)O)c(=O)oc2c1 |
| InChI | InChI=1S/C32H39N3O13S3/c1-4-34(5-2)21-9-11-23-27(18-21)48-31(38)24(30(23)37)12-14-28-32(3,15-6-8-29(36)33-20-50(42,43)44)25-19-22(51(45,46)47)10-13-26(25)35(28)16-7-17-49(39,40)41/h9-14,18-19H,4-8,15-17,20H2,1-3H3,(H4,33,36,39,40,41,42,43,44,45,46,47)/p+1 |
| InChIKey | HONHJILXCQUZJK-UHFFFAOYSA-O |
| XLogP | 3.07 |
| TPSA | 248.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.88 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|