C41H51N2O10S+ — CID 25017915
5-[2-[(E)-2-[8-(dihexylamino)-2,4,5-trioxopyrano[3,2-c]chromen-3-yl]ethenyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]pentanoic acid (PubChem CID 25017915) has the molecular formula C41H51N2O10S+ and a molecular weight of 763.93 g/mol. Its IUPAC name is 5-[2-[(E)-2-[8-(dihexylamino)-2,4,5-trioxopyrano[3,2-c]chromen-3-yl]ethenyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]pentanoic acid.
| Compound Name | 5-[2-[(E)-2-[8-(dihexylamino)-2,4,5-trioxopyrano[3,2-c]chromen-3-yl]ethenyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 25017915 |
| Molecular Formula | C41H51N2O10S+ |
| Molecular Weight | 763.93 g/mol |
| Exact Mass | 763.33 |
| IUPAC Name | 5-[2-[(E)-2-[8-(dihexylamino)-2,4,5-trioxopyrano[3,2-c]chromen-3-yl]ethenyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]pentanoic acid |
| SMILES | CCCCCCN(CCCCCC)c1ccc2c3c(c(=O)oc2c1)C(=O)C(/C=C/C1=[N+](CCCCC(=O)O)c2ccc(S(=O)(=O)O)cc2C1(C)C)C(=O)O3 |
| InChI | InChI=1S/C41H50N2O10S/c1-5-7-9-12-22-42(23-13-10-8-6-2)27-16-18-29-33(25-27)52-40(48)36-37(46)30(39(47)53-38(29)36)19-21-34-41(3,4)31-26-28(54(49,50)51)17-20-32(31)43(34)24-14-11-15-35(44)45/h16-21,25-26,30H,5-15,22-24H2,1-4H3,(H-,44,45,49,50,51)/p+1/b21-19+ |
| InChIKey | QAFJNEJOJGFPAS-XUTLUUPISA-O |
| XLogP | 7.61 |
| TPSA | 171.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.93 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|