C29H36N3O8S2+ — CID 135925299
2-[(E)-2-[7-(diethylamino)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl]ethenyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid (PubChem CID 135925299) has the molecular formula C29H36N3O8S2+ and a molecular weight of 618.75 g/mol. Its IUPAC name is 2-[(E)-2-[7-(diethylamino)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl]ethenyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid.
| Compound Name | 2-[(E)-2-[7-(diethylamino)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl]ethenyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 135925299 |
| Molecular Formula | C29H36N3O8S2+ |
| Molecular Weight | 618.75 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | 2-[(E)-2-[7-(diethylamino)-4-hydroxy-1-methyl-2-oxoquinolin-3-yl]ethenyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
| SMILES | CCN(CC)c1ccc2c(O)c(/C=C/C3=[N+](CCCS(=O)(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)C)c(=O)n(C)c2c1 |
| InChI | InChI=1S/C29H35N3O8S2/c1-6-31(7-2)19-9-11-21-25(17-19)30(5)28(34)22(27(21)33)12-14-26-29(3,4)23-18-20(42(38,39)40)10-13-24(23)32(26)15-8-16-41(35,36)37/h9-14,17-18H,6-8,15-16H2,1-5H3,(H2,35,36,37,38,39,40)/p+1 |
| InChIKey | QVSGBYVELMOCOX-UHFFFAOYSA-O |
| XLogP | 3.70 |
| TPSA | 157.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|