C36H49N2O9S2+ — CID 54678144
2-[(E)-2-[7-(dihexylamino)-4-hydroxy-2-oxochromen-3-yl]ethenyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid (PubChem CID 54678144) has the molecular formula C36H49N2O9S2+ and a molecular weight of 717.93 g/mol. Its IUPAC name is 2-[(E)-2-[7-(dihexylamino)-4-hydroxy-2-oxochromen-3-yl]ethenyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid.
| Compound Name | 2-[(E)-2-[7-(dihexylamino)-4-hydroxy-2-oxochromen-3-yl]ethenyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 54678144 |
| Molecular Formula | C36H49N2O9S2+ |
| Molecular Weight | 717.93 g/mol |
| Exact Mass | 717.29 |
| IUPAC Name | 2-[(E)-2-[7-(dihexylamino)-4-hydroxy-2-oxochromen-3-yl]ethenyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
| SMILES | CCCCCCN(CCCCCC)c1ccc2c(O)c(/C=C/C3=[N+](CCCS(=O)(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)C)c(=O)oc2c1 |
| InChI | InChI=1S/C36H48N2O9S2/c1-5-7-9-11-20-37(21-12-10-8-6-2)26-14-16-28-32(24-26)47-35(40)29(34(28)39)17-19-33-36(3,4)30-25-27(49(44,45)46)15-18-31(30)38(33)22-13-23-48(41,42)43/h14-19,24-25H,5-13,20-23H2,1-4H3,(H2,41,42,43,44,45,46)/p+1 |
| InChIKey | MROXQJCEJMIUIE-UHFFFAOYSA-O |
| XLogP | 7.08 |
| TPSA | 165.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.93 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|