C20H32Cl2N2O — CID 54767909
2-[(3,4-dichlorophenyl)-morpholin-4-ylmethyl]-N,N-dimethylheptan-1-amine (PubChem CID 54767909) has the molecular formula C20H32Cl2N2O and a molecular weight of 387.40 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)-morpholin-4-ylmethyl]-N,N-dimethylheptan-1-amine.
| Compound Name | 2-[(3,4-dichlorophenyl)-morpholin-4-ylmethyl]-N,N-dimethylheptan-1-amine |
|---|---|
| PubChem CID | 54767909 |
| Molecular Formula | C20H32Cl2N2O |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)-morpholin-4-ylmethyl]-N,N-dimethylheptan-1-amine |
| SMILES | CCCCCC(CN(C)C)C(c1ccc(Cl)c(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C20H32Cl2N2O/c1-4-5-6-7-17(15-23(2)3)20(24-10-12-25-13-11-24)16-8-9-18(21)19(22)14-16/h8-9,14,17,20H,4-7,10-13,15H2,1-3H3 |
| InChIKey | RJAZSGVYSFEDQO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|