C20H32Cl3NOS — CID 131885093
1-(3,4-dichlorophenyl)-4-[(dimethylamino)methyl]-1-ethylsulfanylnonan-3-one;hydrochloride (PubChem CID 131885093) has the molecular formula C20H32Cl3NOS and a molecular weight of 440.91 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4-[(dimethylamino)methyl]-1-ethylsulfanylnonan-3-one;hydrochloride.
| Compound Name | 1-(3,4-dichlorophenyl)-4-[(dimethylamino)methyl]-1-ethylsulfanylnonan-3-one;hydrochloride |
|---|---|
| PubChem CID | 131885093 |
| Molecular Formula | C20H32Cl3NOS |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4-[(dimethylamino)methyl]-1-ethylsulfanylnonan-3-one;hydrochloride |
| SMILES | CCCCCC(CN(C)C)C(=O)CC(SCC)c1ccc(Cl)c(Cl)c1.Cl |
| InChI | InChI=1S/C20H31Cl2NOS.ClH/c1-5-7-8-9-16(14-23(3)4)19(24)13-20(25-6-2)15-10-11-17(21)18(22)12-15;/h10-12,16,20H,5-9,13-14H2,1-4H3;1H |
| InChIKey | QHKMEVYGFUTIQC-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|