C27H38F13NO3Si2 — CID 54770336
(NE)-N-[1-[3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptylidene]hydroxylamine (PubChem CID 54770336) has the molecular formula C27H38F13NO3Si2 and a molecular weight of 727.75 g/mol. Its IUPAC name is (NE)-N-[1-[3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptylidene]hydroxylamine |
|---|---|
| PubChem CID | 54770336 |
| Molecular Formula | C27H38F13NO3Si2 |
| Molecular Weight | 727.75 g/mol |
| Exact Mass | 727.22 |
| IUPAC Name | (NE)-N-[1-[3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptylidene]hydroxylamine |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(CO[Si](C)(C)C(C)(C)C)cc(/C(=N\O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C27H38F13NO3Si2/c1-20(2,3)45(7,8)43-14-16-11-17(15-44-46(9,10)21(4,5)6)13-18(12-16)19(41-42)22(28,29)23(30,31)24(32,33)25(34,35)26(36,37)27(38,39)40/h11-13,42H,14-15H2,1-10H3/b41-19+ |
| InChIKey | BVXZMRRINBBFRU-CCZPUOSUSA-N |
| XLogP | 10.65 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.75 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|