C16H12F12O3 — CID 54771017
[3-[(E)-2,3,3,4,4,5,5,6,6,7,7,7-dodecafluoro-1-(trideuteriomethoxy)hept-1-enyl]-5-(hydroxymethyl)phenyl]methanol (PubChem CID 54771017) has the molecular formula C16H12F12O3 and a molecular weight of 483.26 g/mol. Its IUPAC name is [3-[(E)-2,3,3,4,4,5,5,6,6,7,7,7-dodecafluoro-1-(trideuteriomethoxy)hept-1-enyl]-5-(hydroxymethyl)phenyl]methanol.
| Compound Name | [3-[(E)-2,3,3,4,4,5,5,6,6,7,7,7-dodecafluoro-1-(trideuteriomethoxy)hept-1-enyl]-5-(hydroxymethyl)phenyl]methanol |
|---|---|
| PubChem CID | 54771017 |
| Molecular Formula | C16H12F12O3 |
| Molecular Weight | 483.26 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | [3-[(E)-2,3,3,4,4,5,5,6,6,7,7,7-dodecafluoro-1-(trideuteriomethoxy)hept-1-enyl]-5-(hydroxymethyl)phenyl]methanol |
| SMILES | [2H]C([2H])([2H])O/C(=C(/F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1cc(CO)cc(CO)c1 |
| InChI | InChI=1S/C16H12F12O3/c1-31-10(9-3-7(5-29)2-8(4-9)6-30)11(17)12(18,19)13(20,21)14(22,23)15(24,25)16(26,27)28/h2-4,29-30H,5-6H2,1H3/b11-10+/i1D3 |
| InChIKey | VLEZGNXONVPZCJ-NDRYQWFXSA-N |
| XLogP | 5.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.26 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|