C9H14N2S — CID 55281552
(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)hydrazine (PubChem CID 55281552) has the molecular formula C9H14N2S and a molecular weight of 182.29 g/mol. Its IUPAC name is (6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)hydrazine.
| Compound Name | (6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)hydrazine |
|---|---|
| PubChem CID | 55281552 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)hydrazine |
| SMILES | CC1CCc2cc(NN)sc2C1 |
| InChI | InChI=1S/C9H14N2S/c1-6-2-3-7-5-9(11-10)12-8(7)4-6/h5-6,11H,2-4,10H2,1H3 |
| InChIKey | OYOFYFRYEQPSHO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|