C27H26N2O4S — CID 55389170
2-(2,5-dimethylphenyl)-1,3-dioxo-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)isoindole-5-carboxamide (PubChem CID 55389170) has the molecular formula C27H26N2O4S and a molecular weight of 474.58 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-1,3-dioxo-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)isoindole-5-carboxamide.
| Compound Name | 2-(2,5-dimethylphenyl)-1,3-dioxo-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 55389170 |
| Molecular Formula | C27H26N2O4S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-1,3-dioxo-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)isoindole-5-carboxamide |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)N(Cc4cccs4)CC4CCCO4)cc3C2=O)c1 |
| InChI | InChI=1S/C27H26N2O4S/c1-17-7-8-18(2)24(13-17)29-26(31)22-10-9-19(14-23(22)27(29)32)25(30)28(15-20-5-3-11-33-20)16-21-6-4-12-34-21/h4,6-10,12-14,20H,3,5,11,15-16H2,1-2H3 |
| InChIKey | JGRLROKVIVZLLE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|