C18H22F2N2O4S — CID 55540424
N-[4-[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 55540424) has the molecular formula C18H22F2N2O4S and a molecular weight of 400.45 g/mol. Its IUPAC name is N-[4-[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 55540424 |
| Molecular Formula | C18H22F2N2O4S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-[4-[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | O=C(NCCCC(=O)N(C1CC1)C1CCS(=O)(=O)C1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H22F2N2O4S/c19-12-3-6-15(16(20)10-12)18(24)21-8-1-2-17(23)22(13-4-5-13)14-7-9-27(25,26)11-14/h3,6,10,13-14H,1-2,4-5,7-9,11H2,(H,21,24) |
| InChIKey | KCFKUXQJVCWKLQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|