C21H27N5O3 — CID 55808104
1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[1-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]urea (PubChem CID 55808104) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[1-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]urea.
| Compound Name | 1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[1-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 55808104 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 1-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-3-[1-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]urea |
| SMILES | COc1cc(C(C)NC(=O)NCCNc2ncccc2C#N)ccc1OC(C)C |
| InChI | InChI=1S/C21H27N5O3/c1-14(2)29-18-8-7-16(12-19(18)28-4)15(3)26-21(27)25-11-10-24-20-17(13-22)6-5-9-23-20/h5-9,12,14-15H,10-11H2,1-4H3,(H,23,24)(H2,25,26,27) |
| InChIKey | MUYKDAHCMUVUFP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|