C12H20O2 — CID 561671
(2-ethoxy-2,3,3a,4,7,7a-hexahydro-1H-inden-1-yl)methanol (PubChem CID 561671) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (2-ethoxy-2,3,3a,4,7,7a-hexahydro-1H-inden-1-yl)methanol.
| Compound Name | (2-ethoxy-2,3,3a,4,7,7a-hexahydro-1H-inden-1-yl)methanol |
|---|---|
| PubChem CID | 561671 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (2-ethoxy-2,3,3a,4,7,7a-hexahydro-1H-inden-1-yl)methanol |
| SMILES | CCOC1CC2CC=CCC2C1CO |
| InChI | InChI=1S/C12H20O2/c1-2-14-12-7-9-5-3-4-6-10(9)11(12)8-13/h3-4,9-13H,2,5-8H2,1H3 |
| InChIKey | VMRIXRJWWGWJRF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|