C11H12Br2FN3O4S — CID 56501579
2-[2-(2,6-dibromo-4-fluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide (PubChem CID 56501579) has the molecular formula C11H12Br2FN3O4S and a molecular weight of 461.11 g/mol. Its IUPAC name is 2-[2-(2,6-dibromo-4-fluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide.
| Compound Name | 2-[2-(2,6-dibromo-4-fluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 56501579 |
| Molecular Formula | C11H12Br2FN3O4S |
| Molecular Weight | 461.11 g/mol |
| Exact Mass | 458.89 |
| IUPAC Name | 2-[2-(2,6-dibromo-4-fluorophenyl)sulfonylhydrazinyl]-2-oxo-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)C(=O)NNS(=O)(=O)c1c(Br)cc(F)cc1Br |
| InChI | InChI=1S/C11H12Br2FN3O4S/c1-5(2)15-10(18)11(19)16-17-22(20,21)9-7(12)3-6(14)4-8(9)13/h3-5,17H,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | PWEOXCLIYDAGFO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.11 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|